Difference between revisions of "PWY-5046"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5046 PWY-5046] ==
* smiles:
+
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=KYBJQEICWVEWIL-TUUMQRACSA-M
+
 
* common name:
 
* common name:
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
+
** 2-oxoisovalerate decarboxylation to isobutanoyl-CoA
* molecular weight:
+
* taxonomic range:
** 643.968   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
** 3-methoxy-4-hydroxy-5-heptaprenylbenzoate
+
** 2-oxo acid dehydrogenase complex
** 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid
+
** branched-chain α-keto acid dehydrogenase complex
** 3-heptaprenyl-4-hydroxy-5-methoxybenzoate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
* [[RXN-9287]]
+
* [[1.2.4.4-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[CHC_T00006349001_1]]
 +
*** [[CHC_T00008584001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[2.3.1.168-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008584001_1]]
 +
*** [[CHC_T00006349001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-7719]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00008441001]]
 +
*** [[CHC_T00010287001_1]]
 +
*** [[CHC_T00008584001_1]]
 +
*** [[CHC_T00008441001_1]]
 +
*** [[CHC_T00010287001]]
 +
*** [[CHC_T00006349001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=2-oxoisovalerate decarboxylation to isobutanoyl-CoA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54746223 54746223]
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84454 84454]
+
{{#set: taxonomic range=TAX-2157}}
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C}}
+
{{#set: common name=2-oxo acid dehydrogenase complex|branched-chain α-keto acid dehydrogenase complex}}
{{#set: inchi key=InChIKey=KYBJQEICWVEWIL-TUUMQRACSA-M}}
+
{{#set: reaction found=3}}
{{#set: common name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: total reaction=3}}
{{#set: molecular weight=643.968    }}
+
{{#set: completion rate=100.0}}
{{#set: common name=3-methoxy-4-hydroxy-5-heptaprenylbenzoate|3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-heptaprenyl-4-hydroxy-5-methoxybenzoate}}
+
{{#set: produced by=RXN-9287}}
+

Latest revision as of 15:58, 9 January 2019

Pathway PWY-5046

  • common name:
    • 2-oxoisovalerate decarboxylation to isobutanoyl-CoA
  • taxonomic range:
  • Synonym(s):
    • 2-oxo acid dehydrogenase complex
    • branched-chain α-keto acid dehydrogenase complex

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links