Difference between revisions of "CPD-15667"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16067 RXN-16067] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acyl-sn-glycerol-3-phosph...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16067 RXN-16067] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 971.802   
 +
* inchi key:
 +
** InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J
 
* common name:
 
* common name:
** 1-acyl-sn-glycerol-3-phosphate acyltransferase
+
** 6-cis, 3-oxo-tridecenoyl-CoA
** Lysophosphatidic acid acyltransferase
+
* ec number:
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 6Z, 3-oxo-tridecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-14774]]
** 1 [[CPD0-2113]][c] '''+''' 1 [[Long-Chain-Acyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[1-Stearoyl-L-Phosphatidate]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 1-stearoyl-sn-glycerol 3-phosphate[c] '''+''' 1 a long-chain acyl-[acyl-carrier protein][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00009396001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00009195001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008526001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00009396001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008325001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008713001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[PWY-7587]], oleate biosynthesis III (cyanobacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7587 PWY-7587]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=1-acyl-sn-glycerol-3-phosphate acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657308 90657308]
{{#set: common name=Lysophosphatidic acid acyltransferase}}
+
{{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: ec number=EC-2.3.1.51}}
+
{{#set: molecular weight=971.802    }}
{{#set: gene associated=CHC_T00009396001|CHC_T00009195001|CHC_T00008526001|CHC_T00009396001_1|CHC_T00008325001|CHC_T00008713001}}
+
{{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J}}
{{#set: in pathway=PWY-7587}}
+
{{#set: common name=6-cis, 3-oxo-tridecenoyl-CoA}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=6Z, 3-oxo-tridecenoyl-CoA}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-14774}}
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 16:58, 9 January 2019

Metabolite CPD-15667

  • smiles:
    • CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 971.802
  • inchi key:
    • InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J
  • common name:
    • 6-cis, 3-oxo-tridecenoyl-CoA
  • Synonym(s):
    • 6Z, 3-oxo-tridecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.