Difference between revisions of "CPD-3"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3 CPD-3] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [Mo](=O)(=O)([O-])[O-] |
| + | * molecular weight: | ||
| + | ** 161.953 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MEFBJEMVZONFCJ-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** molybdate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** MoO42- | ||
| + | ** molybdate ion | ||
| + | ** MoO4-2 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8348]] |
| + | * [[TransportSeed_CPD-3]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TransportSeed_CPD-3]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ExchangeSeed_CPD-3]] | ||
== External links == | == External links == | ||
| − | * | + | * BIGG : mobd |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06232 C06232] |
| + | * HMDB : HMDB12260 | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.23023.html 23023] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36264 36264] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24621 24621] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=[Mo](=O)(=O)([O-])[O-]}} |
| − | {{#set: common name= | + | {{#set: molecular weight=161.953 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MEFBJEMVZONFCJ-UHFFFAOYSA-N}} |
| − | {{#set: consumed by= | + | {{#set: common name=molybdate}} |
| − | {{#set: produced by= | + | {{#set: common name=MoO42-|molybdate ion|MoO4-2}} |
| + | {{#set: consumed by=RXN-8348|TransportSeed_CPD-3}} | ||
| + | {{#set: produced by=TransportSeed_CPD-3}} | ||
| + | {{#set: reversible reaction associated=ExchangeSeed_CPD-3}} | ||
Latest revision as of 16:00, 9 January 2019
Contents
Metabolite CPD-3
- smiles:
- [Mo](=O)(=O)([O-])[O-]
- molecular weight:
- 161.953
- inchi key:
- InChIKey=MEFBJEMVZONFCJ-UHFFFAOYSA-N
- common name:
- molybdate
- Synonym(s):
- MoO42-
- molybdate ion
- MoO4-2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"Mo](=O)(=O)([O-])[O-" cannot be used as a page name in this wiki.
