Difference between revisions of "PWY-6982"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] == * smiles: ** C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O * inchi key: **...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6982 PWY-6982] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** umbelliferone biosynthesis |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
− | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
− | + | ** 2 associated gene(s): | |
− | * [[ | + | *** [[CHC_T00008160001_1]] |
− | * [[ | + | *** [[CHC_T00008472001_1]] |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12963 RXN-12963] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12965 RXN-12965] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=umbelliferone biosynthesis}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:01, 9 January 2019
Pathway PWY-6982
- common name:
- umbelliferone biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- 4-COUMARATE--COA-LIGASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: