Difference between revisions of "PWY-2661"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == * smiles: ** C(C1(C(C(C(O1)(COP(=O)([O-])[O...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2661 PWY-2661] ==
* smiles:
+
** C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]
+
* inchi key:
+
** InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J
+
 
* common name:
 
* common name:
** fructose 1,6-bisphosphate
+
** trehalose biosynthesis V
* molecular weight:
+
* taxonomic range:
** 336.085   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** fructose 1,6-biphosphate
 
** fructose 1,6-diphosphate
 
** β-D-fructose 1,6-diphosphate
 
** D-fructose 1,6-diphosphate
 
** D-fructos 1,6-bisphosphate
 
** fructose 1,6-bisphosphate
 
** FBP
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[F16BDEPHOS-RXN]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-4301]]
* [[6PFRUCTPHOS-RXN]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00009540001_1]]
* [[2.7.1.90-RXN]]
+
** 1 reconstruction source(s) associated:
* [[F16ALDOLASE-RXN]]
+
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.141-RXN 3.2.1.141-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=5.4.99.15-RXN 5.4.99.15-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 488-69-7
+
{{#set: common name=trehalose biosynthesis V}}
* Wikipedia : Fructose_1,6-bisphosphate
+
{{#set: taxonomic range=TAX-2157}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460765 5460765]
+
{{#set: reaction found=1}}
* HMDB : HMDB01058
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00354 C00354]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4574223.html 4574223]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32966 32966]
+
* BIGG : fdp
+
{{#set: smiles=C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]}}
+
{{#set: inchi key=InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J}}
+
{{#set: common name=fructose 1,6-bisphosphate}}
+
{{#set: molecular weight=336.085    }}
+
{{#set: common name=fructose 1,6-biphosphate|fructose 1,6-diphosphate|β-D-fructose 1,6-diphosphate|D-fructose 1,6-diphosphate|D-fructos 1,6-bisphosphate|fructose 1,6-bisphosphate|FBP}}
+
{{#set: consumed by=F16BDEPHOS-RXN}}
+
{{#set: produced by=6PFRUCTPHOS-RXN}}
+
{{#set: consumed or produced by=2.7.1.90-RXN|F16ALDOLASE-RXN}}
+

Latest revision as of 16:01, 9 January 2019

Pathway PWY-2661

  • common name:
    • trehalose biosynthesis V
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links