Difference between revisions of "PWY-6123"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-119 CPD1F-119] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=C...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-119 CPD1F-119] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123] ==
* smiles:
+
** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CC(CC2(C)C)O)C))C
+
* inchi key:
+
** InChIKey=KBPHJBAIARWVSC-CFWGZHMLSA-N
+
 
* common name:
 
* common name:
** lutein
+
** inosine-5'-phosphate biosynthesis I
* molecular weight:
+
* taxonomic range:
** 568.881   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** Xanthophyll
+
** IMP biosynthesis I
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''6''' reactions in the full pathway
* [[RXN-5962]]
+
* [[AICARSYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00008097001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[AICARTRANSFORM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009056001_1]]
 +
*** [[CHC_T00009056001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009056001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[SAICARSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009497001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-742 RXN0-742]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-743 RXN0-743]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR01070274
+
* ECOCYC:
* DRUGBANK : DB00137
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6123 PWY-6123]
* PUBCHEM:
+
{{#set: common name=inosine-5'-phosphate biosynthesis I}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245095 25245095]
+
{{#set: taxonomic range=TAX-2}}
* HMDB : HMDB03233
+
{{#set: common name=IMP biosynthesis I}}
* LIGAND-CPD:
+
{{#set: reaction found=4}}
** [http://www.genome.jp/dbget-bin/www_bget?C08601 C08601]
+
{{#set: total reaction=6}}
* CHEBI:
+
{{#set: completion rate=67.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28838 28838]
+
* METABOLIGHTS : MTBLC28838
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CC(CC2(C)C)O)C))C}}
+
{{#set: inchi key=InChIKey=KBPHJBAIARWVSC-CFWGZHMLSA-N}}
+
{{#set: common name=lutein}}
+
{{#set: molecular weight=568.881    }}
+
{{#set: common name=Xanthophyll}}
+
{{#set: produced by=RXN-5962}}
+

Latest revision as of 16:02, 9 January 2019

Pathway PWY-6123

  • common name:
    • inosine-5'-phosphate biosynthesis I
  • taxonomic range:
  • Synonym(s):
    • IMP biosynthesis I

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links