Difference between revisions of "CPD-9663"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THF THF] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 192.168 |
+ | * inchi key: | ||
+ | ** InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N | ||
+ | * common name: | ||
+ | ** 2-epi-5-epi-valiolone | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9140]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84187 84187] |
− | * | + | |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201976 25201976] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C17691 C17691] |
− | + | {{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}} | |
− | + | {{#set: molecular weight=192.168 }} | |
− | + | {{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N}} | |
− | {{#set: smiles=C( | + | {{#set: common name=2-epi-5-epi-valiolone}} |
− | {{#set: | + | {{#set: common name=(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-9140}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: produced by= | + | |
− | + |
Latest revision as of 16:03, 9 January 2019
Contents
Metabolite CPD-9663
- smiles:
- C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
- molecular weight:
- 192.168
- inchi key:
- InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N
- common name:
- 2-epi-5-epi-valiolone
- Synonym(s):
- (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links