Difference between revisions of "CPD-9000"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9539 RXN-9539] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-palmitoyl-[acyl-carrier...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9539 RXN-9539] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9000 CPD-9000] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O
 +
* molecular weight:
 +
** 231.228   
 +
* inchi key:
 +
** InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M
 
* common name:
 
* common name:
** 3-oxo-palmitoyl-[acyl-carrier protein] synthase
+
** 4-(γ-L-glutamylamino)butanoate
** Beta-ketoacyl synthase
+
* ec number:
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** γ-glu-GABA
 +
** γ-glutamyl-γ-aminobutyric acid
 +
** γ-glutamyl-γ-aminobutyrate
 +
** γ-glutamyl-γ-aminobutanoate
 +
** 4-(glutamylamino)butanoate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN0-3942]]
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Myristoyl-ACPs]][c] '''=>''' 1 [[3-oxo-palmitoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a myristoyl-[acp][c] '''=>''' 1 a 3-oxo-palmitoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00009465001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00009465001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
** [[pantograph]]-[[a.taliana]]
+
== Pathways  ==
+
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
** '''31''' reactions found over '''31''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[a.taliana]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
{{#set: common name=3-oxo-palmitoyl-[acyl-carrier protein] synthase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58800 58800]
{{#set: common name=Beta-ketoacyl synthase}}
+
* BIGG : gg4abut
{{#set: ec number=EC-2.3.1.41}}
+
* PUBCHEM:
{{#set: gene associated=CHC_T00009465001|CHC_T00009465001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245457 25245457]
{{#set: in pathway=PWY-5971}}
+
* LIGAND-CPD:
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15767 C15767]
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB12161
{{#set: reconstruction source=a.taliana}}
+
{{#set: smiles=C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=231.228    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M}}
{{#set: reconstruction source=original_genome}}
+
{{#set: common name=4-(γ-L-glutamylamino)butanoate}}
 +
{{#set: common name=γ-glu-GABA|γ-glutamyl-γ-aminobutyric acid|γ-glutamyl-γ-aminobutyrate|γ-glutamyl-γ-aminobutanoate|4-(glutamylamino)butanoate}}
 +
{{#set: consumed by=RXN0-3942}}

Latest revision as of 16:05, 9 January 2019

Metabolite CPD-9000

  • smiles:
    • C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O
  • molecular weight:
    • 231.228
  • inchi key:
    • InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M
  • common name:
    • 4-(γ-L-glutamylamino)butanoate
  • Synonym(s):
    • γ-glu-GABA
    • γ-glutamyl-γ-aminobutyric acid
    • γ-glutamyl-γ-aminobutyrate
    • γ-glutamyl-γ-aminobutanoate
    • 4-(glutamylamino)butanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O" cannot be used as a page name in this wiki.