Difference between revisions of "CPD0-1414"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy....")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1.59 EC-1.2.1.59]
+
** 444.44   
 +
* inchi key:
 +
** InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N
 +
* common name:
 +
** tetracycline
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[TRANS-RXN1HP7-17]]
−
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[GAP]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[DPG]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[TRANS-RXN1HP7-17]]
−
** 1 NAD(P)+[c] '''+''' 1 D-glyceraldehyde 3-phosphate[c] '''+''' 1 phosphate[c] '''<=>''' 1 H+[c] '''+''' 1 1,3-bisphospho-D-glycerate[c] '''+''' 1 NAD(P)H[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009438001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* CHEBI:
−
{{#set: ec number=EC-1.2.1.59}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71392 71392]
−
{{#set: gene associated=CHC_T00009438001_1}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=27885548 27885548]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=444.44    }}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: inchi key=InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N}}
 +
{{#set: common name=tetracycline}}
 +
{{#set: consumed by=TRANS-RXN1HP7-17}}
 +
{{#set: produced by=TRANS-RXN1HP7-17}}

Latest revision as of 16:06, 9 January 2019

Metabolite CPD0-1414

  • smiles:
    • CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))
  • molecular weight:
    • 444.44
  • inchi key:
    • InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N
  • common name:
    • tetracycline
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD0-1414&oldid=21256"