Difference between revisions of "CHC 675"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * smiles: ** C(C([O-])=O)C(=O)C([O-])=O * inchi key: ** InC...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_675 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** petN |
− | * | + | * left end position: |
− | ** | + | ** 95610 |
+ | * transcription direction: | ||
+ | ** POSITIVE | ||
+ | * right end position: | ||
+ | ** 95699 | ||
+ | * centisome position: | ||
+ | ** 53.0913 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | * | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-101]] | |
− | * | + | |
− | * | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: common name=petN}} | |
− | + | {{#set: left end position=95610}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=95699}} | |
− | + | {{#set: centisome position=53.0913 }} | |
− | + | {{#set: reaction associated=PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-101}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 16:07, 9 January 2019
Gene CHC_675
- common name:
- petN
- left end position:
- 95610
- transcription direction:
- POSITIVE
- right end position:
- 95699
- centisome position:
- 53.0913
- Synonym(s):
Reactions associated
- Reaction: PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome