Difference between revisions of "CPD-8617"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008333001_1 == * Synonym(s): == Reactions associated == * SULFITE-REDUCT-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8617 CPD-8617] == |
+ | * smiles: | ||
+ | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C | ||
+ | * molecular weight: | ||
+ | ** 416.686 | ||
+ | * inchi key: | ||
+ | ** InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N | ||
+ | * common name: | ||
+ | ** 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN66-21]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN66-20]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87053 87053] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263322 44263322] | ||
+ | * HMDB : HMDB12173 | ||
+ | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: inchi key=InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N}} | ||
+ | {{#set: common name=4α-hydroxymethyl-5α-cholesta-8-en-3β-ol}} | ||
+ | {{#set: consumed by=RXN66-21}} | ||
+ | {{#set: produced by=RXN66-20}} |
Latest revision as of 16:07, 9 January 2019
Contents
Metabolite CPD-8617
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C
- molecular weight:
- 416.686
- inchi key:
- InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N
- common name:
- 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.