Difference between revisions of "CPD-8617"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008333001_1 == * Synonym(s): == Reactions associated == * SULFITE-REDUCT-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008333001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8617 CPD-8617] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C
 +
* molecular weight:
 +
** 416.686   
 +
* inchi key:
 +
** InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N
 +
* common name:
 +
** 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[SULFITE-REDUCT-RXN]]
+
* [[RXN66-21]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN66-20]]
* [[SO4ASSIM-PWY]]
+
== Reaction(s) of unknown directionality ==
* [[PWY-6683]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=SULFITE-REDUCT-RXN}}
+
* CHEBI:
{{#set: pathway associated=SO4ASSIM-PWY|PWY-6683}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87053 87053]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263322 44263322]
 +
* HMDB : HMDB12173
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C}}
 +
{{#set: molecular weight=416.686    }}
 +
{{#set: inchi key=InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N}}
 +
{{#set: common name=4α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: consumed by=RXN66-21}}
 +
{{#set: produced by=RXN66-20}}

Latest revision as of 16:07, 9 January 2019

Metabolite CPD-8617

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C
  • molecular weight:
    • 416.686
  • inchi key:
    • InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N
  • common name:
    • 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.