Difference between revisions of "P23-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** reductive TCA cycle I |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-200783] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** reductive tricarboxylic acid cycle |
− | ** | + | ** reductive tricarboxylic acid pathway |
− | ** | + | ** reductive citric acid cycle |
− | ** | + | ** reverse citric acid cycle |
− | ** | + | ** carbon fixation |
− | ** | + | ** CO2 fixation |
+ | ** reductive carboxylic acid cycle | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''10''' reactions found over '''12''' reactions in the full pathway | |
− | + | * [[ACONITATEDEHYDR-RXN]] | |
− | * [[ | + | ** 3 associated gene(s): |
− | * [[ | + | *** [[CHC_T00009087001_1]] |
− | * [[RXN- | + | *** [[CHC_T00008781001_1]] |
− | * [[RXN- | + | *** [[CHC_T00008781001]] |
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[ACONITATEHYDR-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00009087001_1]] | ||
+ | *** [[CHC_T00008781001]] | ||
+ | *** [[CHC_T00008781001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[ATP-CITRATE-PRO-S--LYASE-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[CHC_T00009158001]] | ||
+ | *** [[CHC_T00009045001_1]] | ||
+ | *** [[CHC_T00009158001_1]] | ||
+ | *** [[CHC_T00009045001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[FUMHYDR-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008951001_1]] | ||
+ | *** [[CHC_T00008951001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[ISOCITDEH-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00009580001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[MALATE-DEH-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00009292001_1]] | ||
+ | *** [[CHC_T00008733001_1]] | ||
+ | *** [[CHC_T00008600001_1]] | ||
+ | *** [[CHC_T00008733001]] | ||
+ | *** [[CHC_T00009350001_1]] | ||
+ | *** [[CHC_T00009173001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PEPCARBOX-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00008437001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PEPSYNTH-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008992001_1]] | ||
+ | *** [[CHC_T00008789001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[PYRUFLAVREDUCT-RXN]] | ||
+ | ** 9 associated gene(s): | ||
+ | *** [[CHC_T00008442001_1]] | ||
+ | *** [[CHC_T00003376001_1]] | ||
+ | *** [[CHC_T00001730001_1]] | ||
+ | *** [[CHC_T00001454001_1]] | ||
+ | *** [[CHC_T00003402001_1]] | ||
+ | *** [[CHC_T00000866001_1]] | ||
+ | *** [[CHC_T00009061001_1]] | ||
+ | *** [[CHC_T00008758001_1]] | ||
+ | *** [[CHC_T00000865001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[SUCCCOASYN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009212001_1]] | ||
+ | *** [[CHC_T00008602001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=reductive TCA cycle I}} | |
− | + | {{#set: taxonomic range=TAX-3052}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-68336}} | |
− | + | {{#set: taxonomic range=TAX-200783}} | |
− | + | {{#set: common name=reductive tricarboxylic acid cycle|reductive tricarboxylic acid pathway|reductive citric acid cycle|reverse citric acid cycle|carbon fixation|CO2 fixation|reductive carboxylic acid cycle}} | |
− | + | {{#set: reaction found=10}} | |
− | + | {{#set: total reaction=12}} | |
− | + | {{#set: completion rate=83.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 16:07, 9 January 2019
Pathway P23-PWY
- common name:
- reductive TCA cycle I
- taxonomic range:
- Synonym(s):
- reductive tricarboxylic acid cycle
- reductive tricarboxylic acid pathway
- reductive citric acid cycle
- reverse citric acid cycle
- carbon fixation
- CO2 fixation
- reductive carboxylic acid cycle
Reaction(s) found
10 reactions found over 12 reactions in the full pathway
- ACONITATEDEHYDR-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- ACONITATEHYDR-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- ATP-CITRATE-PRO-S--LYASE-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- FUMHYDR-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- ISOCITDEH-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- MALATE-DEH-RXN
- 6 associated gene(s):
- 4 reconstruction source(s) associated:
- PEPCARBOX-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PEPSYNTH-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- PYRUFLAVREDUCT-RXN
- 9 associated gene(s):
- 1 reconstruction source(s) associated:
- SUCCCOASYN-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated: