Difference between revisions of "P23-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] ==
* smiles:
+
** C(=O)([O-])C(OP(=O)([O-])[O-])CO
+
* inchi key:
+
** InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K
+
 
* common name:
 
* common name:
** 2-phospho-D-glycerate
+
** reductive TCA cycle I
* molecular weight:
+
* taxonomic range:
** 183.034   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-200783]
 
* Synonym(s):
 
* Synonym(s):
** 2-phospho-(D)-glycerate
+
** reductive tricarboxylic acid cycle
** 2-phospho-(R)-glycerate
+
** reductive tricarboxylic acid pathway
** 2-phospho-D-glyceric acid
+
** reductive citric acid cycle
** 2-P-D-glycerate
+
** reverse citric acid cycle
** D-Glycerate 2-phosphate
+
** carbon fixation
** D-2-phosphoglycerate
+
** CO2 fixation
 +
** reductive carboxylic acid cycle
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''10''' reactions found over '''12''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[ACONITATEDEHYDR-RXN]]
* [[3PGAREARR-RXN]]
+
** 3 associated gene(s):
* [[2PGADEHYDRAT-RXN]]
+
*** [[CHC_T00009087001_1]]
* [[RXN-15513]]
+
*** [[CHC_T00008781001_1]]
* [[RXN-15510]]
+
*** [[CHC_T00008781001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00009087001_1]]
 +
*** [[CHC_T00008781001]]
 +
*** [[CHC_T00008781001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009158001]]
 +
*** [[CHC_T00009045001_1]]
 +
*** [[CHC_T00009158001_1]]
 +
*** [[CHC_T00009045001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008951001_1]]
 +
*** [[CHC_T00008951001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ISOCITDEH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009580001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[MALATE-DEH-RXN]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00009292001_1]]
 +
*** [[CHC_T00008733001_1]]
 +
*** [[CHC_T00008600001_1]]
 +
*** [[CHC_T00008733001]]
 +
*** [[CHC_T00009350001_1]]
 +
*** [[CHC_T00009173001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008437001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PEPSYNTH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008992001_1]]
 +
*** [[CHC_T00008789001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
** 9 associated gene(s):
 +
*** [[CHC_T00008442001_1]]
 +
*** [[CHC_T00003376001_1]]
 +
*** [[CHC_T00001730001_1]]
 +
*** [[CHC_T00001454001_1]]
 +
*** [[CHC_T00003402001_1]]
 +
*** [[CHC_T00000866001_1]]
 +
*** [[CHC_T00009061001_1]]
 +
*** [[CHC_T00008758001_1]]
 +
*** [[CHC_T00000865001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009212001_1]]
 +
*** [[CHC_T00008602001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 2553-59-5
+
{{#set: common name=reductive TCA cycle I}}
* METABOLIGHTS : MTBLC58289
+
{{#set: taxonomic range=TAX-3052}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1224}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467846 40467846]
+
{{#set: taxonomic range=TAX-2157}}
* HMDB : HMDB03391
+
{{#set: taxonomic range=TAX-68336}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-200783}}
** [http://www.genome.jp/dbget-bin/www_bget?C00631 C00631]
+
{{#set: common name=reductive tricarboxylic acid cycle|reductive tricarboxylic acid pathway|reductive citric acid cycle|reverse citric acid cycle|carbon fixation|CO2 fixation|reductive carboxylic acid cycle}}
* CHEBI:
+
{{#set: reaction found=10}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58289 58289]
+
{{#set: total reaction=12}}
* BIGG : 2pg
+
{{#set: completion rate=83.0}}
{{#set: smiles=C(=O)([O-])C(OP(=O)([O-])[O-])CO}}
+
{{#set: inchi key=InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K}}
+
{{#set: common name=2-phospho-D-glycerate}}
+
{{#set: molecular weight=183.034    }}
+
{{#set: common name=2-phospho-(D)-glycerate|2-phospho-(R)-glycerate|2-phospho-D-glyceric acid|2-P-D-glycerate|D-Glycerate 2-phosphate|D-2-phosphoglycerate}}
+
{{#set: consumed or produced by=3PGAREARR-RXN|2PGADEHYDRAT-RXN|RXN-15513|RXN-15510}}
+

Latest revision as of 16:07, 9 January 2019

Pathway P23-PWY

  • common name:
    • reductive TCA cycle I
  • taxonomic range:
  • Synonym(s):
    • reductive tricarboxylic acid cycle
    • reductive tricarboxylic acid pathway
    • reductive citric acid cycle
    • reverse citric acid cycle
    • carbon fixation
    • CO2 fixation
    • reductive carboxylic acid cycle

Reaction(s) found

10 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links