Difference between revisions of "CPD-12904"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * molecular weight: | ||
+ | ** 871.642 | ||
* inchi key: | * inchi key: | ||
** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J | ** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J | ||
* common name: | * common name: | ||
** (2E)-5-methylhexa-2,4-dienoyl-CoA | ** (2E)-5-methylhexa-2,4-dienoyl-CoA | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 21: | Line 21: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468] | ** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468] | ||
{{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: molecular weight=871.642 }} | ||
{{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}} | {{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}} | ||
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}} | {{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}} | ||
− | |||
{{#set: consumed by=RXN-11919}} | {{#set: consumed by=RXN-11919}} |
Latest revision as of 17:08, 9 January 2019
Contents
Metabolite CPD-12904
- smiles:
- CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 871.642
- inchi key:
- InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
- common name:
- (2E)-5-methylhexa-2,4-dienoyl-CoA
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.