Difference between revisions of "CPD-12904"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_OXYGEN-MOLECULE TransportSeed_OXYGEN-MOLECULE] == * direction: ** LEFT-TO-RIGHT * Syn...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_OXYGEN-MOLECULE TransportSeed_OXYGEN-MOLECULE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 871.642   
 +
* inchi key:
 +
** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
 +
* common name:
 +
** (2E)-5-methylhexa-2,4-dienoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-11919]]
** 1.0 [[OXYGEN-MOLECULE]][e] '''=>''' 1.0 [[OXYGEN-MOLECULE]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1.0 oxygen[e] '''=>''' 1.0 oxygen[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[manual]]:
+
** [[added to manage seeds from extracellular to cytosol compartment]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176]
{{#set: reconstruction category=manual}}
+
* LIGAND-CPD:
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468]
 +
{{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: molecular weight=871.642    }}
 +
{{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}}
 +
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}}
 +
{{#set: consumed by=RXN-11919}}

Latest revision as of 17:08, 9 January 2019

Metabolite CPD-12904

  • smiles:
    • CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 871.642
  • inchi key:
    • InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
  • common name:
    • (2E)-5-methylhexa-2,4-dienoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.