Difference between revisions of "ALPHA-GLUCOSE-16-BISPHOSPHATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-]) |
| − | ** | + | * molecular weight: |
| − | ** | + | ** 336.085 |
| + | * inchi key: | ||
| + | ** InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** α-glucose 1,6-bisphosphate |
* Synonym(s): | * Synonym(s): | ||
| + | ** α-D-glucose 1,6-P2 | ||
| + | ** α-D-glucopyranose 1,6-bisphosphate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-16998]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-16997]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58392 58392] |
| − | {{#set: | + | * CAS : 10139-18-1 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201676 25201676] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01231 C01231] |
| − | {{#set: | + | * HMDB : HMDB03514 |
| + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])}} | ||
| + | {{#set: molecular weight=336.085 }} | ||
| + | {{#set: inchi key=InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J}} | ||
| + | {{#set: common name=α-glucose 1,6-bisphosphate}} | ||
| + | {{#set: common name=α-D-glucose 1,6-P2|α-D-glucopyranose 1,6-bisphosphate}} | ||
| + | {{#set: consumed by=RXN-16998}} | ||
| + | {{#set: produced by=RXN-16997}} | ||
Latest revision as of 17:08, 9 January 2019
Contents
Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE
- smiles:
- C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])
- molecular weight:
- 336.085
- inchi key:
- InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J
- common name:
- α-glucose 1,6-bisphosphate
- Synonym(s):
- α-D-glucose 1,6-P2
- α-D-glucopyranose 1,6-bisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.
