Difference between revisions of "PWY-3641"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-carnitine degradation III |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''2''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[1.1.1.39-RXN]] | |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[CHC_T00009563001_1]] | ||
+ | *** [[CHC_T00008878001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-6002]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00008341001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5921 RXN-5921] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=L-carnitine degradation III}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 17:09, 9 January 2019
Pathway PWY-3641
- common name:
- L-carnitine degradation III
- taxonomic range:
- Synonym(s):
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- 1.1.1.39-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-6002
- 1 associated gene(s):
- 2 reconstruction source(s) associated: