Difference between revisions of "ACETYL-ETCETERA-L-ASPARAGINE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-389 PWY66-389] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1) |
+ | * molecular weight: | ||
+ | ** 335.313 | ||
+ | * inchi key: | ||
+ | ** InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine |
* Synonym(s): | * Synonym(s): | ||
+ | ** 1-β-aspartyl-N-acetyl-D-glucosaminylamine | ||
+ | ** N4-(acetyl-β-D-glucosaminyl)asparagine | ||
+ | ** N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[3.5.1.26-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58080 58080] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201322 25201322] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04540 C04540] | ||
+ | * HMDB : HMDB00489 | ||
+ | {{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)}} | ||
+ | {{#set: molecular weight=335.313 }} | ||
+ | {{#set: inchi key=InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N}} | ||
+ | {{#set: common name=N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine}} | ||
+ | {{#set: common name=1-β-aspartyl-N-acetyl-D-glucosaminylamine|N4-(acetyl-β-D-glucosaminyl)asparagine|N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine}} | ||
+ | {{#set: consumed by=3.5.1.26-RXN}} |
Latest revision as of 16:10, 9 January 2019
Contents
Metabolite ACETYL-ETCETERA-L-ASPARAGINE
- smiles:
- CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)
- molecular weight:
- 335.313
- inchi key:
- InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N
- common name:
- N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine
- Synonym(s):
- 1-β-aspartyl-N-acetyl-D-glucosaminylamine
- N4-(acetyl-β-D-glucosaminyl)asparagine
- N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)" cannot be used as a page name in this wiki.