Difference between revisions of "CPD-12116"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8014 RXN-8014] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8014 RXN-8014] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1]
+
** 568.881   
 +
* inchi key:
 +
** InChIKey=UFAXPZAZHZPELJ-ROTSUDQPSA-N
 +
* common name:
 +
** demethylmenaquinol-6
 
* Synonym(s):
 
* Synonym(s):
 +
** DMKH2-6
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9220]]
−
** 1 [[SINAPALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''=>''' 1 [[NADPH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[SINAPATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 sinapaldehyde[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c] '''=>''' 1 NADPH[c] '''+''' 2 H+[c] '''+''' 1 sinapate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008575001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-5168]], ferulate and sinapate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5168 PWY-5168]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07442 R07442]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84539 84539]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.2.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479495 45479495]
−
{{#set: gene associated=CHC_T00008575001_1}}
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}}
−
{{#set: in pathway=PWY-5168}}
+
{{#set: molecular weight=568.881    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=UFAXPZAZHZPELJ-ROTSUDQPSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=demethylmenaquinol-6}}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: common name=DMKH2-6}}
 +
{{#set: consumed by=RXN-9220}}

Latest revision as of 16:11, 9 January 2019

Metabolite CPD-12116

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
  • molecular weight:
    • 568.881
  • inchi key:
    • InChIKey=UFAXPZAZHZPELJ-ROTSUDQPSA-N
  • common name:
    • demethylmenaquinol-6
  • Synonym(s):
    • DMKH2-6

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-12116&oldid=21401"