Difference between revisions of "RXN-9003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9003 RXN-9003] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39]
−
* common name:
+
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
−
* molecular weight:
+
−
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-13]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ALL-TRANS-HEXAPRENYL-DIPHOSPHATE]][c] '''+''' 1 [[4-hydroxybenzoate]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[3-HEXAPRENYL-4-HYDROXYBENZOATE]][c]
−
* [[RXN66-12]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 all-trans-hexaprenyl diphosphate[c] '''+''' 1 4-hydroxybenzoate[c] '''=>''' 1 diphosphate[c] '''+''' 1 3-hexaprenyl-4-hydroxybenzoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00007345001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00003042001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00002263001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00005639001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00004833001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-7235]], superpathway of ubiquinol-6 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7235 PWY-7235]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY3O-19]], ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-19 PWY3O-19]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05616 R05616]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
+
{{#set: ec number=EC-2.5.1.39}}
−
* HMDB : HMDB12159
+
{{#set: gene associated=CHC_T00007345001_1|CHC_T00003042001_1|CHC_T00002263001_1|CHC_T00005639001_1|CHC_T00004833001_1}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: in pathway=PWY-7235|PWY3O-19}}
−
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
−
{{#set: molecular weight=442.724    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN66-13}}
+
−
{{#set: produced by=RXN66-12}}
+

Latest revision as of 16:12, 9 January 2019

Reaction RXN-9003

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7235, superpathway of ubiquinol-6 biosynthesis (eukaryotic): PWY-7235
    • 3 reactions found over 7 reactions in the full pathway
  • PWY3O-19, ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic): PWY3O-19
    • 2 reactions found over 8 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-9003&oldid=21416"