Difference between revisions of "CPD-14808"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7432 PWY-7432] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7432 PWY-7432] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C1(C(C(C(C(C1O)O)=O)O)O)O
 +
* molecular weight:
 +
** 178.141   
 +
* inchi key:
 +
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
 
* common name:
 
* common name:
** L-phenylalanine biosynthesis III (cytosolic, plants)
+
** scyllo-inosose
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-keto-myo-inositol
 +
** 2,4,6/3,5-pentahydroxycyclohexanone
 +
** 2-inosose
 +
** 2-keto-scyllo-inositol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''3''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[PREPHENATEDEHYDRAT-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
** [[PHEAMINOTRANS-RXN]]
+
== Reaction(s) not found ==
+
* '''1''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-15200 RXN-15200]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* CHEBI:
{{#set: common name=L-phenylalanine biosynthesis III (cytosolic, plants)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
{{#set: reaction found=3}}
+
* PUBCHEM:
{{#set: reaction not found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
 +
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
 +
{{#set: molecular weight=178.141    }}
 +
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
 +
{{#set: common name=scyllo-inosose}}
 +
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
 +
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}

Latest revision as of 16:15, 9 January 2019

Metabolite CPD-14808

  • smiles:
    • C1(C(C(C(C(C1O)O)=O)O)O)O
  • molecular weight:
    • 178.141
  • inchi key:
    • InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
  • common name:
    • scyllo-inosose
  • Synonym(s):
    • 2-keto-myo-inositol
    • 2,4,6/3,5-pentahydroxycyclohexanone
    • 2-inosose
    • 2-keto-scyllo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links