Difference between revisions of "CPD-10793"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS CYS] == * smiles: ** C(S)C(C(=O)[O-])[N+] * inchi key: ** InChIKey=XUJNEKJLAYXESH-REOHCLBHS...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C(=O)COP(=O)([O-])[O-] |
| + | * molecular weight: | ||
| + | ** 166.027 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** hydroxypyruvaldehyde phosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2,3-dioxopropyl dihydrogen phosphate |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-17808]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58860 58860] |
| − | * | + | |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21126161 21126161] |
| − | + | ||
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16849 C16849] |
| − | * | + | * CHEMSPIDER: |
| − | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.19993665.html 19993665] |
| − | + | {{#set: smiles=[CH](=O)C(=O)COP(=O)([O-])[O-]}} | |
| − | {{#set: smiles= | + | {{#set: molecular weight=166.027 }} |
| − | + | {{#set: inchi key=InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L}} | |
| − | + | {{#set: common name=hydroxypyruvaldehyde phosphate}} | |
| − | {{#set: molecular weight= | + | {{#set: common name=2,3-dioxopropyl dihydrogen phosphate}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17808}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: consumed | + | |
Latest revision as of 16:15, 9 January 2019
Contents
Metabolite CPD-10793
- smiles:
- [CH](=O)C(=O)COP(=O)([O-])[O-]
- molecular weight:
- 166.027
- inchi key:
- InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L
- common name:
- hydroxypyruvaldehyde phosphate
- Synonym(s):
- 2,3-dioxopropyl dihydrogen phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
