Difference between revisions of "PWY-7187"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (R)-demethy...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pyrimidine deoxyribonucleotides de novo biosynthesis II |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[DTDPKIN-RXN]] | |
− | * [[RXN- | + | ** 4 associated gene(s): |
− | == Reaction(s) | + | *** [[CHC_T00009233001_1]] |
− | * [ | + | *** [[CHC_T00009258001_1]] |
+ | *** [[CHC_T00009258001]] | ||
+ | *** [[CHC_T00009233001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[DTMPKI-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00002059001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[DUTP-PYROP-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009365001_1]] | ||
+ | *** [[CHC_T00002427001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[THYMIDYLATESYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00010030001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DCTP-DEAM-RXN DCTP-DEAM-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-723 RXN0-723] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-724 RXN0-724] | ||
== External links == | == External links == | ||
− | + | * ECOCYC: | |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7187 PWY-7187] | |
− | {{#set: | + | {{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis II}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2157}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
− | {{#set: | + | {{#set: reaction found=4}} |
− | {{#set: | + | {{#set: total reaction=7}} |
− | {{#set: | + | {{#set: completion rate=56.99999999999999}} |
Latest revision as of 17:18, 9 January 2019
Pathway PWY-7187
- common name:
- pyrimidine deoxyribonucleotides de novo biosynthesis II
- taxonomic range:
- Synonym(s):
Reaction(s) found
4 reactions found over 7 reactions in the full pathway
- DTDPKIN-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- DTMPKI-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- DUTP-PYROP-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- THYMIDYLATESYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: