Difference between revisions of "PWY-5269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5269 PWY-5269] ==
* smiles:
+
** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
* inchi key:
+
** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
+
 
* common name:
 
* common name:
** (5Z)-tetradecenoyl-CoA
+
** cardiolipin biosynthesis II
* molecular weight:
+
* taxonomic range:
** 971.845   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* Synonym(s):
 
* Synonym(s):
** cis-tetradec-5-enoyl-CoA
 
** 14:1 cis-5
 
** 14:1(n-9)
 
** (5Z)-tetradec-5-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14576]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
* [[RXN-17783]]
+
* [[PHOSPHAGLYPSYN-RXN]]
== Reaction(s) known to produce the compound ==
+
** 4 associated gene(s):
* [[RXN-17782]]
+
*** [[CHC_T00009507001_1]]
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00009507001]]
 +
*** [[CHC_T00008428001]]
 +
*** [[CHC_T00008428001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PGPPHOSPHA-RXN PGPPHOSPHA-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8141 RXN-8141]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5269 PWY-5269]
* CHEBI:
+
{{#set: common name=cardiolipin biosynthesis II}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650]
+
{{#set: taxonomic range=TAX-2759}}
{{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}}
+
{{#set: total reaction=3}}
{{#set: common name=(5Z)-tetradecenoyl-CoA}}
+
{{#set: completion rate=33.0}}
{{#set: molecular weight=971.845    }}
+
{{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}}
+
{{#set: consumed by=RXN-14576|RXN-17783}}
+
{{#set: produced by=RXN-17782}}
+

Latest revision as of 16:20, 9 January 2019

Pathway PWY-5269

  • common name:
    • cardiolipin biosynthesis II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links