Difference between revisions of "PWY-5269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == * smiles: ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5269 PWY-5269] ==
* smiles:
+
** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]
+
* inchi key:
+
** InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E
+
 
* common name:
 
* common name:
** cobalt-precorrin-2
+
** cardiolipin biosynthesis II
* molecular weight:
+
* taxonomic range:
** 912.701   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* Synonym(s):
 
* Synonym(s):
** cobalt-dihydrosirohydrochlorin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[PHOSPHAGLYPSYN-RXN]]
* [[RXN-8759]]
+
** 4 associated gene(s):
 +
*** [[CHC_T00009507001_1]]
 +
*** [[CHC_T00009507001]]
 +
*** [[CHC_T00008428001]]
 +
*** [[CHC_T00008428001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PGPPHOSPHA-RXN PGPPHOSPHA-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8141 RXN-8141]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820486 91820486]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5269 PWY-5269]
* CHEBI:
+
{{#set: common name=cardiolipin biosynthesis II}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3790 3790]
+
{{#set: taxonomic range=TAX-2759}}
{{#set: smiles=CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E}}
+
{{#set: total reaction=3}}
{{#set: common name=cobalt-precorrin-2}}
+
{{#set: completion rate=33.0}}
{{#set: molecular weight=912.701    }}
+
{{#set: common name=cobalt-dihydrosirohydrochlorin}}
+
{{#set: consumed or produced by=RXN-8759}}
+

Latest revision as of 17:20, 9 January 2019

Pathway PWY-5269

  • common name:
    • cardiolipin biosynthesis II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links