Difference between revisions of "CPD-15199"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6642 PWY-6642] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15199 CPD-15199] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC1(OC(C(C1O)O)OP([O-])([O-])=O)
 +
* molecular weight:
 +
** 212.096   
 +
* inchi key:
 +
** InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L
 
* common name:
 
* common name:
** (R)-cysteate degradation
+
** 5-deoxy-α-ribose 1-phosphate
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-11737]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [[RXN-14304]]
* [http://metacyc.org/META/NEW-IMAGE?object=R230-RXN R230-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11691 RXN-11691]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: common name=(R)-cysteate degradation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58749 58749]
{{#set: reaction found=1}}
+
* PUBCHEM:
{{#set: reaction not found=3}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351655 51351655]
{{#set: completion rate=33.0}}
+
{{#set: smiles=CC1(OC(C(C1O)O)OP([O-])([O-])=O)}}
 +
{{#set: molecular weight=212.096    }}
 +
{{#set: inchi key=InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L}}
 +
{{#set: common name=5-deoxy-α-ribose 1-phosphate}}
 +
{{#set: reversible reaction associated=RXN-14304}}

Latest revision as of 16:20, 9 January 2019

Metabolite CPD-15199

  • smiles:
    • CC1(OC(C(C1O)O)OP([O-])([O-])=O)
  • molecular weight:
    • 212.096
  • inchi key:
    • InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L
  • common name:
    • 5-deoxy-α-ribose 1-phosphate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(OC(C(C1O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.