Difference between revisions of "CPD-15199"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6642 PWY-6642] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15199 CPD-15199] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC1(OC(C(C1O)O)OP([O-])([O-])=O) |
+ | * molecular weight: | ||
+ | ** 212.096 | ||
+ | * inchi key: | ||
+ | ** InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 5-deoxy-α-ribose 1-phosphate |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | * [[RXN-14304]] |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58749 58749] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: reaction | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351655 51351655] |
+ | {{#set: smiles=CC1(OC(C(C1O)O)OP([O-])([O-])=O)}} | ||
+ | {{#set: molecular weight=212.096 }} | ||
+ | {{#set: inchi key=InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L}} | ||
+ | {{#set: common name=5-deoxy-α-ribose 1-phosphate}} | ||
+ | {{#set: reversible reaction associated=RXN-14304}} |
Latest revision as of 16:20, 9 January 2019
Contents
Metabolite CPD-15199
- smiles:
- CC1(OC(C(C1O)O)OP([O-])([O-])=O)
- molecular weight:
- 212.096
- inchi key:
- InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L
- common name:
- 5-deoxy-α-ribose 1-phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(OC(C(C1O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.