Difference between revisions of "PWY0-1329"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * inchi key: ** InChIKey=ZQISRDCJN...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1329 PWY0-1329] ==
* smiles:
+
** C1(NC=NC=1CC(CO)[N+])
+
* inchi key:
+
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
+
 
* common name:
 
* common name:
** histidinol
+
** succinate to cytochrome bo oxidase electron transfer
* molecular weight:
+
* taxonomic range:
** 142.18   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** histidol
 
** L-histidinol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-8001]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
* [[HISTIDPHOS-RXN]]
+
** 6 associated gene(s):
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
+
*** [[CHC_T00007584001_1]]
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00008943001_1]]
* [[HISTOLDEHYD-RXN]]
+
*** [[CHC_T00007286001_1]]
 +
*** [[CHC_T00008943001]]
 +
*** [[CHC_T00006990001_1]]
 +
*** [[CHC_T00001817001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5268 RXN0-5268]
 
== External links  ==
 
== External links  ==
* CAS : 501-28-0
+
* ECOCYC:
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1329 PWY0-1329]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
+
{{#set: common name=succinate to cytochrome bo oxidase electron transfer}}
* KNAPSACK : C00007479
+
{{#set: taxonomic range=TAX-2}}
* HMDB : HMDB03431
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
+
{{#set: completion rate=50.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
+
* BIGG : histd
+
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
+
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
+
{{#set: common name=histidinol}}
+
{{#set: molecular weight=142.18    }}
+
{{#set: common name=histidol|L-histidinol}}
+
{{#set: consumed by=RXN-8001}}
+
{{#set: produced by=HISTIDPHOS-RXN|HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.}}
+
{{#set: consumed or produced by=HISTOLDEHYD-RXN}}
+

Latest revision as of 16:20, 9 January 2019

Pathway PWY0-1329

  • common name:
    • succinate to cytochrome bo oxidase electron transfer
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links