Difference between revisions of "CPD-18777"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6124 PWY-6124] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == |
− | * | + | * smiles: |
− | ** [ | + | ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) |
+ | * molecular weight: | ||
+ | ** 244.224 | ||
+ | * inchi key: | ||
+ | ** InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M | ||
* common name: | * common name: | ||
− | ** | + | ** mycosporine glycine |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17368]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[extended_RXN-17371]] | |
− | + | * [[RXN-17371]] | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)}} |
− | {{#set: | + | {{#set: molecular weight=244.224 }} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M}} |
− | {{#set: | + | {{#set: common name=mycosporine glycine}} |
− | {{#set: reaction | + | {{#set: produced by=RXN-17368}} |
+ | {{#set: reversible reaction associated=extended_RXN-17371|RXN-17371}} |
Latest revision as of 17:21, 9 January 2019
Contents
Metabolite CPD-18777
- smiles:
- COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)
- molecular weight:
- 244.224
- inchi key:
- InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M
- common name:
- mycosporine glycine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)" cannot be used as a page name in this wiki.