Difference between revisions of "CPD-8609"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009153001_1 == * Synonym(s): == Reactions associated == * 2.4.1.83-RXN ** pantograph-galdieria.sulphuraria * RXN-16602 ** p...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == |
| + | * smiles: | ||
| + | ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C | ||
| + | * molecular weight: | ||
| + | ** 412.698 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N | ||
| + | * common name: | ||
| + | ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-14]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[RXN66-13]] |
| − | + | * [[RXN-13707]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167817 167817] | ||
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}} | ||
| + | {{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}} | ||
| + | {{#set: consumed by=RXN66-14}} | ||
| + | {{#set: produced by=RXN66-13|RXN-13707}} | ||
Latest revision as of 17:21, 9 January 2019
Contents
Metabolite CPD-8609
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
- molecular weight:
- 412.698
- inchi key:
- InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
- common name:
- 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.
