Difference between revisions of "CHC T00008410001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] ==
+
== Gene CHC_T00008410001 ==
* smiles:
+
* left end position:
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 175476
* inchi key:
+
* transcription direction:
** InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
+
** NEGATIVE
* common name:
+
* right end position:
** ergosta-5,7-dienol
+
** 176615
* molecular weight:
+
* centisome position:
** 398.671    
+
** 43.67291    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[AIRS-RXN]]
* [[RXN-13883]]
+
** Source: [[annotation-original_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6122]]
 +
* [[PWY-6277]]
 +
* [[PWY-6121]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=175476}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5326970 5326970]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=176615}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66918 66918]
+
{{#set: centisome position=43.67291    }}
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction associated=AIRS-RXN}}
{{#set: inchi key=InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N}}
+
{{#set: pathway associated=PWY-6122|PWY-6277|PWY-6121}}
{{#set: common name=ergosta-5,7-dienol}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN-13883}}
+

Latest revision as of 17:21, 9 January 2019

Gene CHC_T00008410001

  • left end position:
    • 175476
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 176615
  • centisome position:
    • 43.67291
  • Synonym(s):

Reactions associated

Pathways associated

External links