Difference between revisions of "PWY-7388"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388] ==
−
* smiles:
+
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C
+
−
* inchi key:
+
−
** InChIKey=YYGNTYWPHWGJRM-AAJYLUCBSA-N
+
 
* common name:
 
* common name:
−
** squalene
+
** octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast)
−
* molecular weight:
+
* taxonomic range:
−
** 410.725   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* Synonym(s):
 
* Synonym(s):
 +
** octanoyl-ACP biosynthesis (mitochondria, yeast)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''8''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN-13724]]
+
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
−
* [[RXN66-281]]
+
** 2 associated gene(s):
−
* [[RXN-13162]]
+
*** [[CHC_T00009465001]]
−
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00009465001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[4.2.1.58-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009190001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
** 8 associated gene(s):
 +
*** [[CHC_T00009359001_1]]
 +
*** [[CHC_640]]
 +
*** [[CHC_T00009359001]]
 +
*** [[CHC_T00008359001]]
 +
*** [[CHC_T00009426001_1]]
 +
*** [[CHC_T00008359001_1]]
 +
*** [[CHC_T00007145001_1]]
 +
*** [[CHC_55]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008765001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-14972]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-14973]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9514]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008477001]]
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008517001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9516]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515]
 
== External links  ==
 
== External links  ==
−
* CAS : 111-02-4
+
{{#set: common name=octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast)}}
−
* LIPID_MAPS : LMPR0106010002
+
{{#set: taxonomic range=TAX-2759}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=638072 638072]
+
{{#set: common name=octanoyl-ACP biosynthesis (mitochondria, yeast)}}
−
* HMDB : HMDB00256
+
{{#set: reaction found=8}}
−
* LIGAND-CPD:
+
{{#set: total reaction=9}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00751 C00751]
+
{{#set: completion rate=89.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15440 15440]
+
−
* METABOLIGHTS : MTBLC15440
+
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C}}
+
−
{{#set: inchi key=InChIKey=YYGNTYWPHWGJRM-AAJYLUCBSA-N}}
+
−
{{#set: common name=squalene}}
+
−
{{#set: molecular weight=410.725    }}
+
−
{{#set: produced by=RXN-13724|RXN66-281|RXN-13162}}
+

Latest revision as of 17:22, 9 January 2019

Pathway PWY-7388

  • common name:
    • octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast)
  • taxonomic range:
  • Synonym(s):
    • octanoyl-ACP biosynthesis (mitochondria, yeast)

Reaction(s) found

8 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

"octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-7388&oldid=21658"