Difference between revisions of "PWY-7840"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7840 PWY-7840] ==
* smiles:
+
** CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)
+
* inchi key:
+
** InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J
+
 
* common name:
 
* common name:
** α-linolenoyl-CoA
+
** gala-series glycosphingolipids biosynthesis
* molecular weight:
+
* taxonomic range:
** 1023.921   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 
* Synonym(s):
 
* Synonym(s):
** 18:3Δ9,12,15
+
** ganglioside GM4 biosynthesis
** (9Z,12Z,15Z)-octadecatrienoyl-CoA
+
** galaglycosphingolipids biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''5''' reactions in the full pathway
* [[LINOLENOYL-RXN]]
+
* [[RXN-18301]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[CHC_T00009336001]]
 +
*** [[CHC_T00008551001]]
 +
*** [[CHC_T00008762001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
* [[RXN-18303]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00009336001]]
 +
*** [[CHC_T00008551001]]
 +
*** [[CHC_T00008762001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.47-RXN 2.4.1.47-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18291 RXN-18291]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18302 RXN-18302]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=gala-series glycosphingolipids biosynthesis}}
** [http://www.genome.jp/dbget-bin/www_bget?C16162 C16162]
+
{{#set: taxonomic range=TAX-33208}}
* CHEBI:
+
{{#set: common name=ganglioside GM4 biosynthesis|galaglycosphingolipids biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=51985 51985]
+
{{#set: reaction found=2}}
* METABOLIGHTS : MTBLC51985
+
{{#set: total reaction=5}}
* PUBCHEM:
+
{{#set: completion rate=40.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859601 49859601]
+
* HMDB : HMDB06290
+
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)}}
+
{{#set: inchi key=InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J}}
+
{{#set: common name=α-linolenoyl-CoA}}
+
{{#set: molecular weight=1023.921    }}
+
{{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA}}
+
{{#set: produced by=LINOLENOYL-RXN}}
+

Latest revision as of 17:23, 9 January 2019

Pathway PWY-7840

  • common name:
    • gala-series glycosphingolipids biosynthesis
  • taxonomic range:
  • Synonym(s):
    • ganglioside GM4 biosynthesis
    • galaglycosphingolipids biosynthesis

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links