Difference between revisions of "CPD-9865"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008380001 == * left end position: ** 4374 * transcription direction: ** NEGATIVE * right end position: ** 6080 * centisome position: ** 8.0005...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9865 CPD-9865] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C |
| − | * | + | * molecular weight: |
| − | ** | + | ** 805.321 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 2-methoxy-6-(all-trans-decaprenyl)phenol |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9234]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50774 50774] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC50774 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25010760 25010760] |
| − | {{#set: | + | * HMDB : HMDB60250 |
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C}} | ||
| + | {{#set: molecular weight=805.321 }} | ||
| + | {{#set: inchi key=InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N}} | ||
| + | {{#set: common name=2-methoxy-6-(all-trans-decaprenyl)phenol}} | ||
| + | {{#set: consumed by=RXN-9234}} | ||
Latest revision as of 16:24, 9 January 2019
Contents
Metabolite CPD-9865
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C
- molecular weight:
- 805.321
- inchi key:
- InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N
- common name:
- 2-methoxy-6-(all-trans-decaprenyl)phenol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
