Difference between revisions of "PWY-7219"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == * smiles: ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7219 PWY-7219] ==
−
* smiles:
+
−
** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C
+
−
* inchi key:
+
−
** InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K
+
 
* common name:
 
* common name:
−
** presqualene diphosphate
+
** adenosine ribonucleotides de novo biosynthesis
−
* molecular weight:
+
* taxonomic range:
−
** 583.66   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-13724]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
* [[RXN66-281]]
+
* [[ADENYL-KIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 5 associated gene(s):
−
* [[RXN-12263]]
+
*** [[CHC_T00004355001_1]]
−
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00006303001_1]]
 +
*** [[CHC_T00008779001_1]]
 +
*** [[CHC_T00000884001_1]]
 +
*** [[CHC_T00002564001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009314001_1]]
 +
*** [[CHC_T00009314001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[AMPSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008097001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ATPSYN-RXN]]
 +
** 24 associated gene(s):
 +
*** [[CHC_T00010175001_1]]
 +
*** [[CHC_T00009194001]]
 +
*** [[CHC_T00010194001_1]]
 +
*** [[CHC_T00009073001_1]]
 +
*** [[CHC_T00006891001_1]]
 +
*** [[CHC_T00010260001_1]]
 +
*** [[CHC_T00005903001_1]]
 +
*** [[CHC_T00010194001]]
 +
*** [[CHC_T00006782001_1]]
 +
*** [[CHC_T00010260001]]
 +
*** [[CHC_T00005827001_1]]
 +
*** [[CHC_T00008719001_1]]
 +
*** [[CHC_T00007788001_1]]
 +
*** [[CHC_T00010124001_1]]
 +
*** [[CHC_T00004901001_1]]
 +
*** [[CHC_T00010146001]]
 +
*** [[CHC_T00008404001_1]]
 +
*** [[CHC_T00010053001_1]]
 +
*** [[CHC_840]]
 +
*** [[CHC_T00005161001_1]]
 +
*** [[CHC_T00006181001_1]]
 +
*** [[CHC_T00006631001_1]]
 +
*** [[CHC_T00009194001_1]]
 +
*** [[CHC_760]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* ECOCYC:
−
** [http://www.genome.jp/dbget-bin/www_bget?C03428 C03428]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7219 PWY-7219]
−
* CHEBI:
+
{{#set: common name=adenosine ribonucleotides de novo biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57310 57310]
+
{{#set: taxonomic range=TAX-2759}}
−
* METABOLIGHTS : MTBLC57310
+
{{#set: taxonomic range=TAX-2157}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244634 25244634]
+
{{#set: reaction found=4}}
−
* HMDB : HMDB01278
+
{{#set: total reaction=4}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K}}
+
−
{{#set: common name=presqualene diphosphate}}
+
−
{{#set: molecular weight=583.66    }}
+
−
{{#set: consumed by=RXN-13724|RXN66-281}}
+
−
{{#set: produced by=RXN-12263}}
+

Latest revision as of 17:25, 9 January 2019

Pathway PWY-7219

  • common name:
    • adenosine ribonucleotides de novo biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-7219&oldid=21732"