Difference between revisions of "HISTIDINOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCCCOASYN-RXN SUCCCOASYN-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCCCOASYN-RXN SUCCCOASYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(NC=NC=1CC(CO)[N+])
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/6.2.1.5 EC-6.2.1.5]
+
** 142.18   
 +
* inchi key:
 +
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
 +
* common name:
 +
** histidinol
 
* Synonym(s):
 
* Synonym(s):
−
** Succinate thiokinase
+
** histidol
−
** succinyl CoA synthesis
+
** L-histidinol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8001]]
−
** 1 [[SUC]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[SUC-COA]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
−
** 1 succinate[c] '''+''' 1 ATP[c] '''+''' 1 coenzyme A[c] '''<=>''' 1 ADP[c] '''+''' 1 phosphate[c] '''+''' 1 succinyl-CoA[c]
+
* [[HISTIDPHOS-RXN]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
* [[HISTOLDEHYD-RXN]]
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008602001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00009212001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
+
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
−
* [[P42-PWY]], incomplete reductive TCA cycle: [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7384]], anaerobic energy metabolism (invertebrates, mitochondrial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384]
+
−
** '''5''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-5392]], reductive TCA cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392]
+
−
** '''5''' reactions found over '''12''' reactions in the full pathway
+
−
* [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
+
−
** '''9''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
+
−
** '''8''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-5537]], pyruvate fermentation to acetate V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
+
−
** '''9''' reactions found over '''18''' reactions in the full pathway
+
−
* [[PWY-5538]], pyruvate fermentation to acetate VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5538 PWY-5538]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
+
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
−
* [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
+
−
** '''9''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* KNAPSACK : C00007479
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17661 17661]
+
* BIGG : histd
−
* LIGAND-RXN:
+
* CAS : 501-28-0
−
** [http://www.genome.jp/dbget-bin/www_bget?R00405 R00405]
+
* HMDB : HMDB03431
−
* UNIPROT:
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/O28098 O28098]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
−
** [http://www.uniprot.org/uniprot/P53594 P53594]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/O28733 O28733]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
−
** [http://www.uniprot.org/uniprot/P45101 P45101]
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P45102 P45102]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
−
** [http://www.uniprot.org/uniprot/Q9JUT0 Q9JUT0]
+
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
−
** [http://www.uniprot.org/uniprot/Q58643 Q58643]
+
{{#set: molecular weight=142.18    }}
−
** [http://www.uniprot.org/uniprot/O26663 O26663]
+
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
−
** [http://www.uniprot.org/uniprot/P80886 P80886]
+
{{#set: common name=histidinol}}
−
** [http://www.uniprot.org/uniprot/Q9PHY1 Q9PHY1]
+
{{#set: common name=histidol|L-histidinol}}
−
** [http://www.uniprot.org/uniprot/Q9JUS9 Q9JUS9]
+
{{#set: consumed by=RXN-8001}}
−
** [http://www.uniprot.org/uniprot/P80865 P80865]
+
{{#set: produced by=HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.|HISTIDPHOS-RXN}}
−
** [http://www.uniprot.org/uniprot/Q9PHY0 Q9PHY0]
+
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}
−
** [http://www.uniprot.org/uniprot/O67729 O67729]
+
−
** [http://www.uniprot.org/uniprot/O67546 O67546]
+
−
** [http://www.uniprot.org/uniprot/P53593 P53593]
+
−
** [http://www.uniprot.org/uniprot/P0AGE9 P0AGE9]
+
−
** [http://www.uniprot.org/uniprot/P0A836 P0A836]
+
−
** [http://www.uniprot.org/uniprot/O82662 O82662]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: ec number=EC-6.2.1.5}}
+
−
{{#set: common name=Succinate thiokinase|succinyl CoA synthesis}}
+
−
{{#set: gene associated=CHC_T00008602001_1|CHC_T00009212001_1}}
+
−
{{#set: in pathway=PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|PWY-6969|PWY-5537|PWY-6728|PWY-5538|PWY-5690|PWY66-398|TCA}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+

Latest revision as of 16:29, 9 January 2019

Metabolite HISTIDINOL

  • smiles:
    • C1(NC=NC=1CC(CO)[N+])
  • molecular weight:
    • 142.18
  • inchi key:
    • InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
  • common name:
    • histidinol
  • Synonym(s):
    • histidol
    • L-histidinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

  • [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
  • HISTIDPHOS-RXN

Reaction(s) of unknown directionality

External links

  • KNAPSACK : C00007479
  • BIGG : histd
  • CAS : 501-28-0
  • HMDB : HMDB03431
  • CHEBI:
  • LIGAND-CPD:
  • PUBCHEM:
"C1(NC=NC=1CC(CO)[N+])" cannot be used as a page name in this wiki.



"HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49." cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=HISTIDINOL&oldid=21828"