Difference between revisions of "DUTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 464.112 | ||
* inchi key: | * inchi key: | ||
** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J | ** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J | ||
* common name: | * common name: | ||
** dUTP | ** dUTP | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** deoxy-UTP | ** deoxy-UTP | ||
| Line 16: | Line 16: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[DUTP-PYROP-RXN]] | * [[DUTP-PYROP-RXN]] | ||
| − | |||
* [[RXN-14219]] | * [[RXN-14219]] | ||
| + | * [[RXN-14199]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[DUDPKIN-RXN]] | * [[DUDPKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * BIGG : dutp | ||
* CAS : 1173-82-6 | * CAS : 1173-82-6 | ||
| − | |||
| − | |||
* HMDB : HMDB01191 | * HMDB : HMDB01191 | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408] | ||
{{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | {{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
| + | {{#set: molecular weight=464.112 }} | ||
{{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}} | {{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}} | ||
{{#set: common name=dUTP}} | {{#set: common name=dUTP}} | ||
| − | |||
{{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} | {{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} | ||
| − | {{#set: consumed by=DUTP-PYROP-RXN|RXN- | + | {{#set: consumed by=DUTP-PYROP-RXN|RXN-14219|RXN-14199}} |
{{#set: produced by=DUDPKIN-RXN}} | {{#set: produced by=DUDPKIN-RXN}} | ||
Latest revision as of 16:30, 9 January 2019
Contents
Metabolite DUTP
- smiles:
- C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- molecular weight:
- 464.112
- inchi key:
- InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
- common name:
- dUTP
- Synonym(s):
- deoxy-UTP
- 2'-deoxyuridine-5'-triphosphate
- deoxyuridine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
