Difference between revisions of "PWY0-1313"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1313 PWY0-1313] ==
* smiles:
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1)
+
* inchi key:
+
** InChIKey=NNUPTRSALHLEEI-AVRCVIBKSA-N
+
 
* common name:
 
* common name:
** 3-demethylubiquinol-10
+
** acetate conversion to acetyl-CoA
* molecular weight:
+
* taxonomic range:
** 851.347   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-9237]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETATE--COA-LIGASE-RXN]]
* [[RXN-9236]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00008320001_1]]
 +
*** [[CHC_T00008320001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986074 50986074]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1313 PWY0-1313]
* CHEBI:
+
{{#set: common name=acetate conversion to acetyl-CoA}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64182 64182]
+
{{#set: taxonomic range=TAX-33154}}
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1)}}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: inchi key=InChIKey=NNUPTRSALHLEEI-AVRCVIBKSA-N}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=3-demethylubiquinol-10}}
+
{{#set: reaction found=1}}
{{#set: molecular weight=851.347    }}
+
{{#set: total reaction=1}}
{{#set: consumed by=RXN-9237}}
+
{{#set: completion rate=100.0}}
{{#set: produced by=RXN-9236}}
+

Latest revision as of 16:30, 9 January 2019

Pathway PWY0-1313

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links