Difference between revisions of "CPD-8890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10642 RXN-10642] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/4.1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10642 RXN-10642] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/4.1.1.37 EC-4.1.1.37]
+
** 384.301   
 +
* inchi key:
 +
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
 +
* common name:
 +
** betanidin quinone
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-11444]][c] '''+''' 4 [[PROTON]][c] '''<=>''' 4 [[CARBON-DIOXIDE]][c] '''+''' 1 [[COPROPORPHYRINOGEN_I]][c]
+
* [[RXN-8635]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 uroporphyrinogen-I[c] '''+''' 4 H+[c] '''<=>''' 4 CO2[c] '''+''' 1 coproporphyrinogen I[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008531001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31239 31239]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
* LIGAND-RXN:
+
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
** [http://www.genome.jp/dbget-bin/www_bget?R04972 R04972]
+
{{#set: molecular weight=384.301    }}
{{#set: direction=REVERSIBLE}}
+
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
{{#set: ec number=EC-4.1.1.37}}
+
{{#set: common name=betanidin quinone}}
{{#set: gene associated=CHC_T00008531001_1}}
+
{{#set: produced by=RXN-8635}}
{{#set: in pathway=}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Latest revision as of 16:30, 9 January 2019

Metabolite CPD-8890

  • smiles:
    • C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
  • molecular weight:
    • 384.301
  • inchi key:
    • InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
  • common name:
    • betanidin quinone
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.