Difference between revisions of "CPD-1103"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00002892001_1 == * Synonym(s): == Reactions associated == * CYSTEINE--TRNA-LIGASE-RXN ** pantograph-galdieria.sulphuraria == Pathwa...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == |
+ | * smiles: | ||
+ | ** C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N) | ||
+ | * molecular weight: | ||
+ | ** 311.291 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N | ||
+ | * common name: | ||
+ | ** taxiphyllin | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (R)-4-hydroxymandelonitrile β-D-glucoside | ||
+ | ** (2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile | ||
+ | ** (R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-13600]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 21401-21-8 |
− | {{#set: | + | * HMDB : HMDB30704 |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.96890.html 96890] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16267 16267] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01855 C01855] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107721 107721] | ||
+ | {{#set: smiles=C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N)}} | ||
+ | {{#set: molecular weight=311.291 }} | ||
+ | {{#set: inchi key=InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N}} | ||
+ | {{#set: common name=taxiphyllin}} | ||
+ | {{#set: common name=(R)-4-hydroxymandelonitrile β-D-glucoside|(2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile|(R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile}} | ||
+ | {{#set: consumed by=RXN-13600}} |
Latest revision as of 17:30, 9 January 2019
Contents
Metabolite CPD-1103
- smiles:
- C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N)
- molecular weight:
- 311.291
- inchi key:
- InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N
- common name:
- taxiphyllin
- Synonym(s):
- (R)-4-hydroxymandelonitrile β-D-glucoside
- (2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile
- (R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links