Difference between revisions of "CPD-3943"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009303001_1 == * Synonym(s): == Reactions associated == * 1.14.13.70-RXN ** pantograph-galdieria.sulphuraria * RXN-11881 ** [...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == |
| + | * smiles: | ||
| + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * molecular weight: | ||
| + | ** 416.686 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N | ||
| + | * common name: | ||
| + | ** (22α)-hydroxy-campesterol | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (22S)-22-hydroxy-campesterol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-4225]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72331 72331] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341628 15341628] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15795 C15795] | ||
| + | * LIPID_MAPS : LMST01031115 | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.9308624.html 9308624] | ||
| + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: molecular weight=416.686 }} | ||
| + | {{#set: inchi key=InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N}} | ||
| + | {{#set: common name=(22α)-hydroxy-campesterol}} | ||
| + | {{#set: common name=(22S)-22-hydroxy-campesterol}} | ||
| + | {{#set: produced by=RXN-4225}} | ||
Latest revision as of 17:32, 9 January 2019
Contents
Metabolite CPD-3943
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 416.686
- inchi key:
- InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
- common name:
- (22α)-hydroxy-campesterol
- Synonym(s):
- (22S)-22-hydroxy-campesterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
