Difference between revisions of "C3"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009244001 == * left end position: ** 31897 * transcription direction: ** POSITIVE * right end position: ** 33297 * centisome position: ** 72.7...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C3 C3] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C(=O)NC(C([O-])=O)C)NC(=O)C(CCCC[N+])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O) |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1146.922 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PFMVORMCVGOQKR-XNCOKRRHSA-K |
| − | * | + | * common name: |
| − | ** | + | ** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine |
* Synonym(s): | * Synonym(s): | ||
| + | ** UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala-D-Ala) | ||
| + | ** UDP-MurNAc-pentapeptide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-8975]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70758 70758] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289103 86289103] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04846 C04846] | ||
| + | {{#set: smiles=CC(C(=O)NC(C([O-])=O)C)NC(=O)C(CCCC[N+])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)}} | ||
| + | {{#set: molecular weight=1146.922 }} | ||
| + | {{#set: inchi key=InChIKey=PFMVORMCVGOQKR-XNCOKRRHSA-K}} | ||
| + | {{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine}} | ||
| + | {{#set: common name=UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala-D-Ala)|UDP-MurNAc-pentapeptide}} | ||
| + | {{#set: reversible reaction associated=RXN-8975}} | ||
Latest revision as of 16:33, 9 January 2019
Contents
Metabolite C3
- smiles:
- CC(C(=O)NC(C([O-])=O)C)NC(=O)C(CCCC[N+])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)
- molecular weight:
- 1146.922
- inchi key:
- InChIKey=PFMVORMCVGOQKR-XNCOKRRHSA-K
- common name:
- UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine
- Synonym(s):
- UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala-D-Ala)
- UDP-MurNAc-pentapeptide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)NC(C([O-])=O)C)NC(=O)C(CCCC[N+])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)" cannot be used as a page name in this wiki.
