Difference between revisions of "CPD-474"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) | ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) | ||
+ | * molecular weight: | ||
+ | ** 303.248 | ||
* inchi key: | * inchi key: | ||
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M | ** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M | ||
* common name: | * common name: | ||
** (+)-taxifolin | ** (+)-taxifolin | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** trans dihydroquercetin | ** trans dihydroquercetin | ||
Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329] | ||
* CAS : 480-18-2 | * CAS : 480-18-2 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891] | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617] | ** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617] | ||
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}} | {{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}} | ||
+ | {{#set: molecular weight=303.248 }} | ||
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}} | {{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}} | ||
{{#set: common name=(+)-taxifolin}} | {{#set: common name=(+)-taxifolin}} | ||
− | |||
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}} | {{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}} | ||
{{#set: consumed by=RXN-600}} | {{#set: consumed by=RXN-600}} |
Latest revision as of 17:35, 9 January 2019
Contents
Metabolite CPD-474
- smiles:
- C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
- molecular weight:
- 303.248
- inchi key:
- InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
- common name:
- (+)-taxifolin
- Synonym(s):
- trans dihydroquercetin
- (+)-dihydroquercetin
- taxifolin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.