Difference between revisions of "CPD-11517"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008640001 == * left end position: ** 356279 * transcription direction: ** NEGATIVE * right end position: ** 357172 * centisome position: ** 30...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008640001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] ==
* left end position:
+
* smiles:
** 356279
+
** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
* transcription direction:
+
* molecular weight:
** NEGATIVE
+
** 1039.92   
* right end position:
+
* inchi key:
** 357172
+
** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
* centisome position:
+
* common name:
** 30.39109   
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** oxopentenyl-cyclopentane-octanoyl-CoA
 +
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
 +
** OPC-8:0-CoA
 +
** OPC8-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-12440]]
+
* [[RXN-10696]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[RXN-3521]]
+
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-6959]]
+
* [[PWY-6960]]
+
* [[PWY-6961]]
+
* [[PWY-2261]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=356279}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325]
{{#set: right end position=357172}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
{{#set: centisome position=30.39109    }}
+
{{#set: molecular weight=1039.92    }}
{{#set: reaction associated=RXN-12440|RXN-3521}}
+
{{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}}
{{#set: pathway associated=PWY-6959|PWY-6960|PWY-6961|PWY-2261}}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}}
 +
{{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}}
 +
{{#set: consumed by=RXN-10696}}

Latest revision as of 16:35, 9 January 2019

Metabolite CPD-11517

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • molecular weight:
    • 1039.92
  • inchi key:
    • InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
  • common name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
  • Synonym(s):
    • oxopentenyl-cyclopentane-octanoyl-CoA
    • 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
    • OPC-8:0-CoA
    • OPC8-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.


"8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA" cannot be used as a page name in this wiki.