Difference between revisions of "CPD-14423"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009425001 == * left end position: ** 380280 * transcription direction: ** POSITIVE * right end position: ** 381422 * centisome position: ** 58...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009425001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] ==
* left end position:
+
* smiles:
** 380280
+
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* molecular weight:
** POSITIVE
+
** 1089.98   
* right end position:
+
* inchi key:
** 381422
+
** InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J
* centisome position:
+
* common name:
** 58.207848   
+
** 3-oxo-docosapentaenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-5285]]
+
* [[RXN-13443]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[RXN1F-10]]
+
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[CHLOROPHYLL-SYN]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=380280}}
+
* CHEBI:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73863 73863]
{{#set: right end position=381422}}
+
* PUBCHEM:
{{#set: centisome position=58.207848    }}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581097 71581097]
{{#set: reaction associated=RXN-5285|RXN1F-10}}
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: pathway associated=CHLOROPHYLL-SYN}}
+
{{#set: molecular weight=1089.98    }}
 +
{{#set: inchi key=InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J}}
 +
{{#set: common name=3-oxo-docosapentaenoyl-CoA}}
 +
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA}}
 +
{{#set: consumed by=RXN-13443}}

Latest revision as of 16:36, 9 January 2019

Metabolite CPD-14423

  • smiles:
    • CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 1089.98
  • inchi key:
    • InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J
  • common name:
    • 3-oxo-docosapentaenoyl-CoA
  • Synonym(s):
    • (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.