Difference between revisions of "CPD-465"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=H2CO3 H2CO3] == * smiles: ** C(O)(=O)O * inchi key: ** InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-N * c...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == |
* smiles: | * smiles: | ||
| − | ** C(O)(=O)O | + | ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C |
| + | * molecular weight: | ||
| + | ** 583.66 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K |
* common name: | * common name: | ||
| − | ** | + | ** presqualene diphosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13724]] | ||
| + | * [[RXN66-281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12263]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57310 57310] | ||
| + | * METABOLIGHTS : MTBLC57310 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244634 25244634] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03428 C03428] |
| − | * | + | * HMDB : HMDB01278 |
| − | + | {{#set: smiles=CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C}} | |
| − | + | {{#set: molecular weight=583.66 }} | |
| − | + | {{#set: inchi key=InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K}} | |
| − | {{#set: smiles=C(O)(=O)O}} | + | {{#set: common name=presqualene diphosphate}} |
| − | {{#set: | + | {{#set: consumed by=RXN-13724|RXN66-281}} |
| − | {{#set: | + | {{#set: produced by=RXN-12263}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:38, 9 January 2019
Contents
Metabolite CPD-465
- smiles:
- CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C
- molecular weight:
- 583.66
- inchi key:
- InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K
- common name:
- presqualene diphosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C" cannot be used as a page name in this wiki.
