Difference between revisions of "CPD-8611"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008340001_1 == * Synonym(s): == Reactions associated == * ACETYLORNTRANSAM-RXN ** pantograph-galdieria.sulphuraria * ALANINE--G...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8611 CPD-8611] == |
| + | * smiles: | ||
| + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(CO)C(O)CC3)))CC4)))C | ||
| + | * molecular weight: | ||
| + | ** 430.713 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UVSRXDFMOZKKGE-WKYRUEGDSA-N | ||
| + | * common name: | ||
| + | ** 4α-hydroxymethyl-4β-methyl-5α-cholesta-8-en-3β-ol | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-16]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN66-15]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87045 87045] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263321 44263321] | ||
| + | * HMDB : HMDB12171 | ||
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(CO)C(O)CC3)))CC4)))C}} | ||
| + | {{#set: molecular weight=430.713 }} | ||
| + | {{#set: inchi key=InChIKey=UVSRXDFMOZKKGE-WKYRUEGDSA-N}} | ||
| + | {{#set: common name=4α-hydroxymethyl-4β-methyl-5α-cholesta-8-en-3β-ol}} | ||
| + | {{#set: consumed by=RXN66-16}} | ||
| + | {{#set: produced by=RXN66-15}} | ||
Latest revision as of 17:39, 9 January 2019
Contents
Metabolite CPD-8611
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(CO)C(O)CC3)))CC4)))C
- molecular weight:
- 430.713
- inchi key:
- InChIKey=UVSRXDFMOZKKGE-WKYRUEGDSA-N
- common name:
- 4α-hydroxymethyl-4β-methyl-5α-cholesta-8-en-3β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(CO)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
