Difference between revisions of "CPD-17813"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00005531001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * UBIQUITIN--PROTEIN-LI...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00005531001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
 +
* smiles:
 +
** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
 +
* molecular weight:
 +
** 997.883   
 +
* inchi key:
 +
** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
 +
* common name:
 +
** (2E,11Z)-hexadec-2,11-dienoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-15556]]
+
* [[RXN-16558]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways associated ==
+
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7511}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958]
 +
{{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
 +
{{#set: molecular weight=997.883    }}
 +
{{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}}
 +
{{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}}
 +
{{#set: consumed by=RXN-16558}}

Latest revision as of 16:39, 9 January 2019

Metabolite CPD-17813

  • smiles:
    • CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
  • molecular weight:
    • 997.883
  • inchi key:
    • InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
  • common name:
    • (2E,11Z)-hexadec-2,11-dienoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.