Difference between revisions of "L-ASPARTATE-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** [CH](=O)CC([N+])C(=O)[O-] | ** [CH](=O)CC([N+])C(=O)[O-] | ||
+ | * molecular weight: | ||
+ | ** 117.104 | ||
* inchi key: | * inchi key: | ||
** InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N | ** InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N | ||
* common name: | * common name: | ||
** L-aspartate-semialdehyde | ** L-aspartate-semialdehyde | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** L-aspartic 4-semialdehyde | ** L-aspartic 4-semialdehyde | ||
Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[DIHYDRODIPICSYN-RXN]] | * [[DIHYDRODIPICSYN-RXN]] | ||
+ | * [[HOMOSERDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
+ | * BIGG : aspsa | ||
* CAS : 15106-57-7 | * CAS : 15106-57-7 | ||
− | |||
− | |||
* HMDB : HMDB12249 | * HMDB : HMDB12249 | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=537519 537519] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=537519 537519] | ||
− | * | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00441 C00441] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5287708 5287708] | ||
{{#set: smiles=[CH](=O)CC([N+])C(=O)[O-]}} | {{#set: smiles=[CH](=O)CC([N+])C(=O)[O-]}} | ||
+ | {{#set: molecular weight=117.104 }} | ||
{{#set: inchi key=InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N}} | {{#set: inchi key=InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N}} | ||
{{#set: common name=L-aspartate-semialdehyde}} | {{#set: common name=L-aspartate-semialdehyde}} | ||
− | |||
{{#set: common name=L-aspartic 4-semialdehyde|L-aspartate-4-semialdehyde|L-aspartate β-semialdehyde}} | {{#set: common name=L-aspartic 4-semialdehyde|L-aspartate-4-semialdehyde|L-aspartate β-semialdehyde}} | ||
− | {{#set: consumed by= | + | {{#set: consumed by=DIHYDRODIPICSYN-RXN|HOMOSERDEHYDROG-RXN}} |
{{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN}} | {{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN}} |
Latest revision as of 16:39, 9 January 2019
Contents
Metabolite L-ASPARTATE-SEMIALDEHYDE
- smiles:
- [CH](=O)CC([N+])C(=O)[O-]
- molecular weight:
- 117.104
- inchi key:
- InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N
- common name:
- L-aspartate-semialdehyde
- Synonym(s):
- L-aspartic 4-semialdehyde
- L-aspartate-4-semialdehyde
- L-aspartate β-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.