Difference between revisions of "L-ASPARTATE-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6948 PWY-6948] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** [CH](=O)CC([N+])C(=O)[O-] |
| + | * molecular weight: | ||
| + | ** 117.104 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** L-aspartate-semialdehyde |
* Synonym(s): | * Synonym(s): | ||
| + | ** L-aspartic 4-semialdehyde | ||
| + | ** L-aspartate-4-semialdehyde | ||
| + | ** L-aspartate β-semialdehyde | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[DIHYDRODIPICSYN-RXN]] | |
| − | + | * [[HOMOSERDEHYDROG-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : aspsa |
| − | {{#set: common name= | + | * CAS : 15106-57-7 |
| − | {{#set: | + | * HMDB : HMDB12249 |
| − | {{#set: reaction | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=537519 537519] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00441 C00441] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5287708 5287708] | ||
| + | {{#set: smiles=[CH](=O)CC([N+])C(=O)[O-]}} | ||
| + | {{#set: molecular weight=117.104 }} | ||
| + | {{#set: inchi key=InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N}} | ||
| + | {{#set: common name=L-aspartate-semialdehyde}} | ||
| + | {{#set: common name=L-aspartic 4-semialdehyde|L-aspartate-4-semialdehyde|L-aspartate β-semialdehyde}} | ||
| + | {{#set: consumed by=DIHYDRODIPICSYN-RXN|HOMOSERDEHYDROG-RXN}} | ||
| + | {{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN}} | ||
Latest revision as of 17:39, 9 January 2019
Contents
Metabolite L-ASPARTATE-SEMIALDEHYDE
- smiles:
- [CH](=O)CC([N+])C(=O)[O-]
- molecular weight:
- 117.104
- inchi key:
- InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N
- common name:
- L-aspartate-semialdehyde
- Synonym(s):
- L-aspartic 4-semialdehyde
- L-aspartate-4-semialdehyde
- L-aspartate β-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
