Difference between revisions of "CPD-7526"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7643 RXN-7643] == * direction: ** LEFT-TO-RIGHT * common name: ** branched-chain alpha-keto aci...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7643 RXN-7643] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
 +
* molecular weight:
 +
** 540.914   
 +
* inchi key:
 +
** InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N
 
* common name:
 
* common name:
−
** branched-chain alpha-keto acid decarboxylase E1 beta subunit
+
** 9,9'-di-cis-ζ-carotene
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/4.1.1.72 EC-4.1.1.72]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11356]]
−
** 1 [[2-KETO-ISOVALERATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-7000]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-11354]]
−
** 1 3-methyl-2-oxobutanoate[c] '''+''' 1 H+[c] '''=>''' 1 isobutanal[c] '''+''' 1 CO2[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-12242]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008584001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-7396]], butanol and isobutanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396]
+
−
** '''4''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-7111]], pyruvate fermentation to isobutanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7111 PWY-7111]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-5057]], L-valine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5057 PWY-5057]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=branched-chain alpha-keto acid decarboxylase E1 beta subunit}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48716 48716]
−
{{#set: ec number=EC-4.1.1.72}}
+
* PUBCHEM:
−
{{#set: gene associated=CHC_T00008584001}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6440490 6440490]
−
{{#set: in pathway=PWY-7396|PWY-7111|PWY-5057}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15857 C15857]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=original_genome}}
+
** [http://www.chemspider.com/Chemical-Structure.4944750.html 4944750]
 +
* HMDB : HMDB03063
 +
{{#set: smiles=CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
 +
{{#set: molecular weight=540.914    }}
 +
{{#set: inchi key=InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N}}
 +
{{#set: common name=9,9'-di-cis-ζ-carotene}}
 +
{{#set: consumed by=RXN-11356}}
 +
{{#set: produced by=RXN-11354}}
 +
{{#set: reversible reaction associated=RXN-12242}}

Latest revision as of 16:40, 9 January 2019

Metabolite CPD-7526

  • smiles:
    • CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
  • molecular weight:
    • 540.914
  • inchi key:
    • InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N
  • common name:
    • 9,9'-di-cis-ζ-carotene
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-7526&oldid=22085"